C24H16FNO2 — CID 102496981
2-[(4-fluorophenyl)-(1H-indol-3-yl)methyl]indene-1,3-dione (PubChem CID 102496981) has the molecular formula C24H16FNO2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)-(1H-indol-3-yl)methyl]indene-1,3-dione.
| Compound Name | 2-[(4-fluorophenyl)-(1H-indol-3-yl)methyl]indene-1,3-dione |
|---|---|
| PubChem CID | 102496981 |
| Molecular Formula | C24H16FNO2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[(4-fluorophenyl)-(1H-indol-3-yl)methyl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1C(c1ccc(F)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H16FNO2/c25-15-11-9-14(10-12-15)21(19-13-26-20-8-4-3-5-16(19)20)22-23(27)17-6-1-2-7-18(17)24(22)28/h1-13,21-22,26H |
| InChIKey | GEDCZURNYZUGAU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|