C15H26O3Si — CID 102036846
(3aS,4R,7R,7aR)-2,2-dimethyl-7-[(E)-1-trimethylsilylprop-1-en-2-yl]-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 102036846) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is (3aS,4R,7R,7aR)-2,2-dimethyl-7-[(E)-1-trimethylsilylprop-1-en-2-yl]-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4R,7R,7aR)-2,2-dimethyl-7-[(E)-1-trimethylsilylprop-1-en-2-yl]-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 102036846 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (3aS,4R,7R,7aR)-2,2-dimethyl-7-[(E)-1-trimethylsilylprop-1-en-2-yl]-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | C/C(=C\[Si](C)(C)C)[C@H]1C=C[C@@H](O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C15H26O3Si/c1-10(9-19(4,5)6)11-7-8-12(16)14-13(11)17-15(2,3)18-14/h7-9,11-14,16H,1-6H3/b10-9+/t11-,12-,13-,14+/m1/s1 |
| InChIKey | PGESLZHVWIWWLW-DCOHZSIJSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|