C15H28O3 — CID 58304353
(Z)-1-[(4R,5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-5-methylhex-2-en-1-ol (PubChem CID 58304353) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (Z)-1-[(4R,5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-5-methylhex-2-en-1-ol.
| Compound Name | (Z)-1-[(4R,5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-5-methylhex-2-en-1-ol |
|---|---|
| PubChem CID | 58304353 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (Z)-1-[(4R,5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-5-methylhex-2-en-1-ol |
| SMILES | CCC[C@@H]1OC(C)(C)O[C@@H]1C(O)/C=C\CC(C)C |
| InChI | InChI=1S/C15H28O3/c1-6-8-13-14(18-15(4,5)17-13)12(16)10-7-9-11(2)3/h7,10-14,16H,6,8-9H2,1-5H3/b10-7-/t12?,13-,14+/m0/s1 |
| InChIKey | ALOPVQVJDUIMNJ-LWIPETKNSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|