C18H20O3S — CID 102037618
prop-2-enyl (1R)-1,3-dimethyl-2-oxo-4-phenylsulfanylcyclohex-3-ene-1-carboxylate (PubChem CID 102037618) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is prop-2-enyl (1R)-1,3-dimethyl-2-oxo-4-phenylsulfanylcyclohex-3-ene-1-carboxylate.
| Compound Name | prop-2-enyl (1R)-1,3-dimethyl-2-oxo-4-phenylsulfanylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102037618 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | prop-2-enyl (1R)-1,3-dimethyl-2-oxo-4-phenylsulfanylcyclohex-3-ene-1-carboxylate |
| SMILES | C=CCOC(=O)[C@]1(C)CCC(Sc2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C18H20O3S/c1-4-12-21-17(20)18(3)11-10-15(13(2)16(18)19)22-14-8-6-5-7-9-14/h4-9H,1,10-12H2,2-3H3/t18-/m1/s1 |
| InChIKey | SMJWTIKMSYLALZ-GOSISDBHSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|