C7H15N2O6P — CID 102038450
[(2R,3S)-3-acetamido-4-(methylamino)-4-oxobutan-2-yl] dihydrogen phosphate (PubChem CID 102038450) has the molecular formula C7H15N2O6P and a molecular weight of 254.18 g/mol. Its IUPAC name is [(2R,3S)-3-acetamido-4-(methylamino)-4-oxobutan-2-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S)-3-acetamido-4-(methylamino)-4-oxobutan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 102038450 |
| Molecular Formula | C7H15N2O6P |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [(2R,3S)-3-acetamido-4-(methylamino)-4-oxobutan-2-yl] dihydrogen phosphate |
| SMILES | CNC(=O)[C@@H](NC(C)=O)[C@@H](C)OP(=O)(O)O |
| InChI | InChI=1S/C7H15N2O6P/c1-4(15-16(12,13)14)6(7(11)8-3)9-5(2)10/h4,6H,1-3H3,(H,8,11)(H,9,10)(H2,12,13,14)/t4-,6+/m1/s1 |
| InChIKey | XGQQKUZWZBFJOE-XINAWCOVSA-N |
| XLogP | -1.27 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|