C20H18N2O4 — CID 102038664
methyl 2-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-1H-indole-6-carboxylate (PubChem CID 102038664) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is methyl 2-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-1H-indole-6-carboxylate.
| Compound Name | methyl 2-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 102038664 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | methyl 2-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2cc(N3C(=O)OC[C@@H]3Cc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C20H18N2O4/c1-25-19(23)15-8-7-14-11-18(21-17(14)10-15)22-16(12-26-20(22)24)9-13-5-3-2-4-6-13/h2-8,10-11,16,21H,9,12H2,1H3/t16-/m0/s1 |
| InChIKey | CZNHJAYKTALVBJ-INIZCTEOSA-N |
| XLogP | 3.52 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |