C14H27N — CID 102039611
2,2,6,6-tetramethyl-1-[(E)-pent-1-enyl]piperidine (PubChem CID 102039611) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[(E)-pent-1-enyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[(E)-pent-1-enyl]piperidine |
|---|---|
| PubChem CID | 102039611 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[(E)-pent-1-enyl]piperidine |
| SMILES | CCC/C=C/N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C14H27N/c1-6-7-8-12-15-13(2,3)10-9-11-14(15,4)5/h8,12H,6-7,9-11H2,1-5H3/b12-8+ |
| InChIKey | ALYBFGXNTQLCAI-XYOKQWHBSA-N |
| XLogP | 4.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |