C38H30N4 — CID 102040642
4-[[4-[(3,5-diphenyl-1H-pyrazol-4-yl)methyl]phenyl]methyl]-3,5-diphenyl-1H-pyrazole (PubChem CID 102040642) has the molecular formula C38H30N4 and a molecular weight of 542.69 g/mol. Its IUPAC name is 4-[[4-[(3,5-diphenyl-1H-pyrazol-4-yl)methyl]phenyl]methyl]-3,5-diphenyl-1H-pyrazole.
| Compound Name | 4-[[4-[(3,5-diphenyl-1H-pyrazol-4-yl)methyl]phenyl]methyl]-3,5-diphenyl-1H-pyrazole |
|---|---|
| PubChem CID | 102040642 |
| Molecular Formula | C38H30N4 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 4-[[4-[(3,5-diphenyl-1H-pyrazol-4-yl)methyl]phenyl]methyl]-3,5-diphenyl-1H-pyrazole |
| SMILES | c1ccc(-c2n[nH]c(-c3ccccc3)c2Cc2ccc(Cc3c(-c4ccccc4)n[nH]c3-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C38H30N4/c1-5-13-29(14-6-1)35-33(36(40-39-35)30-15-7-2-8-16-30)25-27-21-23-28(24-22-27)26-34-37(31-17-9-3-10-18-31)41-42-38(34)32-19-11-4-12-20-32/h1-24H,25-26H2,(H,39,40)(H,41,42) |
| InChIKey | SAFKZIAHFYVTAD-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |