C15H12N2O4S — CID 21454029
(3,5-diphenyl-1H-pyrazol-4-yl) hydrogen sulfate (PubChem CID 21454029) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is (3,5-diphenyl-1H-pyrazol-4-yl) hydrogen sulfate.
| Compound Name | (3,5-diphenyl-1H-pyrazol-4-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 21454029 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (3,5-diphenyl-1H-pyrazol-4-yl) hydrogen sulfate |
| SMILES | O=S(=O)(O)Oc1c(-c2ccccc2)n[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C15H12N2O4S/c18-22(19,20)21-15-13(11-7-3-1-4-8-11)16-17-14(15)12-9-5-2-6-10-12/h1-10H,(H,16,17)(H,18,19,20) |
| InChIKey | OHPMGIYXBRVIES-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|