C14H20N2O4S — CID 173458849
5-tert-butyl-3-phenyl-1H-pyrazole;methyl hydrogen sulfate (PubChem CID 173458849) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 5-tert-butyl-3-phenyl-1H-pyrazole;methyl hydrogen sulfate.
| Compound Name | 5-tert-butyl-3-phenyl-1H-pyrazole;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 173458849 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 5-tert-butyl-3-phenyl-1H-pyrazole;methyl hydrogen sulfate |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)n[nH]1.COS(=O)(=O)O |
| InChI | InChI=1S/C13H16N2.CH4O4S/c1-13(2,3)12-9-11(14-15-12)10-7-5-4-6-8-10;1-5-6(2,3)4/h4-9H,1-3H3,(H,14,15);1H3,(H,2,3,4) |
| InChIKey | FBAJOGCOPQFFLG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|