C24H36N2 — CID 102043048
N,N'-bis[(1S,1'S,2S,5R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,2'-cyclopropane]-1'-yl]ethane-1,2-diimine (PubChem CID 102043048) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is N,N'-bis[(1S,1'S,2S,5R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,2'-cyclopropane]-1'-yl]ethane-1,2-diimine.
| Compound Name | N,N'-bis[(1S,1'S,2S,5R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,2'-cyclopropane]-1'-yl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 102043048 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | N,N'-bis[(1S,1'S,2S,5R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,2'-cyclopropane]-1'-yl]ethane-1,2-diimine |
| SMILES | CC1(C)[C@@H]2CC[C@]3(C[C@@H]3/N=C/C=N/[C@H]3C[C@]34CC[C@@H]3C[C@H]4C3(C)C)[C@H]1C2 |
| InChI | InChI=1S/C24H36N2/c1-21(2)15-5-7-23(17(21)11-15)13-19(23)25-9-10-26-20-14-24(20)8-6-16-12-18(24)22(16,3)4/h9-10,15-20H,5-8,11-14H2,1-4H3/b25-9+,26-10+/t15-,16-,17+,18+,19+,20+,23+,24+/m1/s1 |
| InChIKey | CZFSKGJLYZAXGV-GPHNUQTJSA-N |
| XLogP | 5.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|