C18H33NO2 — CID 102043855
[(2S,3S,5E,9Z)-2-aminohexadeca-5,9-dien-3-yl] acetate (PubChem CID 102043855) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is [(2S,3S,5E,9Z)-2-aminohexadeca-5,9-dien-3-yl] acetate.
| Compound Name | [(2S,3S,5E,9Z)-2-aminohexadeca-5,9-dien-3-yl] acetate |
|---|---|
| PubChem CID | 102043855 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | [(2S,3S,5E,9Z)-2-aminohexadeca-5,9-dien-3-yl] acetate |
| SMILES | CCCCCC/C=C\CC/C=C/C[C@H](OC(C)=O)[C@H](C)N |
| InChI | InChI=1S/C18H33NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-18(16(2)19)21-17(3)20/h9-10,13-14,16,18H,4-8,11-12,15,19H2,1-3H3/b10-9-,14-13+/t16-,18-/m0/s1 |
| InChIKey | KXTPTPADWLBDGE-IJQVYCSWSA-N |
| XLogP | 4.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|