C21H19ClN2O5 — CID 102045214
methyl 3-(4-chlorophenyl)-2-(1,3-dimethyl-2,5-dioxo-4-phenylimidazolidin-4-yl)-3-oxopropanoate (PubChem CID 102045214) has the molecular formula C21H19ClN2O5 and a molecular weight of 414.85 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-(1,3-dimethyl-2,5-dioxo-4-phenylimidazolidin-4-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-(1,3-dimethyl-2,5-dioxo-4-phenylimidazolidin-4-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 102045214 |
| Molecular Formula | C21H19ClN2O5 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-(1,3-dimethyl-2,5-dioxo-4-phenylimidazolidin-4-yl)-3-oxopropanoate |
| SMILES | COC(=O)C(C(=O)c1ccc(Cl)cc1)C1(c2ccccc2)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C21H19ClN2O5/c1-23-19(27)21(24(2)20(23)28,14-7-5-4-6-8-14)16(18(26)29-3)17(25)13-9-11-15(22)12-10-13/h4-12,16H,1-3H3 |
| InChIKey | BMCKDVXHIPLIAQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|