C52H44N4O8 — CID 139037842
(5S)-5-(1,3-dioxo-1,3-diphenylpropan-2-yl)-1,3-dimethyl-5-phenylimidazolidine-2,4-dione;(5R)-5-(1,3-dioxo-1,3-diphenylpropan-2-yl)-1,3-dimethyl-5-phenylimidazolidine-2,4-dione (PubChem CID 139037842) has the molecular formula C52H44N4O8 and a molecular weight of 852.94 g/mol. Its IUPAC name is (5S)-5-(1,3-dioxo-1,3-diphenylpropan-2-yl)-1,3-dimethyl-5-phenylimidazolidine-2,4-dione;(5R)-5-(1,3-dioxo-1,3-diphenylpropan-2-yl)-1,3-dimethyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(1,3-dioxo-1,3-diphenylpropan-2-yl)-1,3-dimethyl-5-phenylimidazolidine-2,4-dione;(5R)-5-(1,3-dioxo-1,3-diphenylpropan-2-yl)-1,3-dimethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139037842 |
| Molecular Formula | C52H44N4O8 |
| Molecular Weight | 852.94 g/mol |
| Exact Mass | 852.32 |
| IUPAC Name | (5S)-5-(1,3-dioxo-1,3-diphenylpropan-2-yl)-1,3-dimethyl-5-phenylimidazolidine-2,4-dione;(5R)-5-(1,3-dioxo-1,3-diphenylpropan-2-yl)-1,3-dimethyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(C)[C@@](c2ccccc2)(C(C(=O)c2ccccc2)C(=O)c2ccccc2)C1=O.CN1C(=O)N(C)[C@](c2ccccc2)(C(C(=O)c2ccccc2)C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/2C26H22N2O4/c2*1-27-24(31)26(28(2)25(27)32,20-16-10-5-11-17-20)21(22(29)18-12-6-3-7-13-18)23(30)19-14-8-4-9-15-19/h2*3-17,21H,1-2H3/t2*26-/m10/s1 |
| InChIKey | DVOGTSIERMPRBW-UVZIVPAYSA-N |
| XLogP | 7.58 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.94 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|