C28H26O5 — CID 101353890
2-[(2S,4S)-2-tert-butyl-5-oxo-4-phenyl-1,3-dioxolan-4-yl]-1,3-diphenylpropane-1,3-dione (PubChem CID 101353890) has the molecular formula C28H26O5 and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-[(2S,4S)-2-tert-butyl-5-oxo-4-phenyl-1,3-dioxolan-4-yl]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[(2S,4S)-2-tert-butyl-5-oxo-4-phenyl-1,3-dioxolan-4-yl]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 101353890 |
| Molecular Formula | C28H26O5 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[(2S,4S)-2-tert-butyl-5-oxo-4-phenyl-1,3-dioxolan-4-yl]-1,3-diphenylpropane-1,3-dione |
| SMILES | CC(C)(C)[C@@H]1OC(=O)[C@@](c2ccccc2)(C(C(=O)c2ccccc2)C(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C28H26O5/c1-27(2,3)26-32-25(31)28(33-26,21-17-11-6-12-18-21)22(23(29)19-13-7-4-8-14-19)24(30)20-15-9-5-10-16-20/h4-18,22,26H,1-3H3/t26-,28-/m1/s1 |
| InChIKey | OEKFOTWKYHZGBC-IXCJQBJRSA-N |
| XLogP | 5.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|