C25H28O5 — CID 102252985
3-[(S)-[(2S,4S)-2-tert-butyl-5-oxo-4-phenyl-1,3-dioxolan-4-yl]-phenylmethyl]pentane-2,4-dione (PubChem CID 102252985) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is 3-[(S)-[(2S,4S)-2-tert-butyl-5-oxo-4-phenyl-1,3-dioxolan-4-yl]-phenylmethyl]pentane-2,4-dione.
| Compound Name | 3-[(S)-[(2S,4S)-2-tert-butyl-5-oxo-4-phenyl-1,3-dioxolan-4-yl]-phenylmethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 102252985 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 3-[(S)-[(2S,4S)-2-tert-butyl-5-oxo-4-phenyl-1,3-dioxolan-4-yl]-phenylmethyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)[C@@H](c1ccccc1)[C@@]1(c2ccccc2)O[C@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C25H28O5/c1-16(26)20(17(2)27)21(18-12-8-6-9-13-18)25(19-14-10-7-11-15-19)22(28)29-23(30-25)24(3,4)5/h6-15,20-21,23H,1-5H3/t21-,23-,25-/m1/s1 |
| InChIKey | ZVUZPFVEFMQLNE-GZGNHOFSSA-N |
| XLogP | 4.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|