C22H25NO7 — CID 102354439
(2S,5S)-2-tert-butyl-5-[(1R)-1-(4-hydroxy-3-methoxyphenyl)-2-nitroethyl]-5-phenyl-1,3-dioxolan-4-one (PubChem CID 102354439) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is (2S,5S)-2-tert-butyl-5-[(1R)-1-(4-hydroxy-3-methoxyphenyl)-2-nitroethyl]-5-phenyl-1,3-dioxolan-4-one.
| Compound Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-(4-hydroxy-3-methoxyphenyl)-2-nitroethyl]-5-phenyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 102354439 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-(4-hydroxy-3-methoxyphenyl)-2-nitroethyl]-5-phenyl-1,3-dioxolan-4-one |
| SMILES | COc1cc([C@H](C[N+](=O)[O-])[C@@]2(c3ccccc3)O[C@H](C(C)(C)C)OC2=O)ccc1O |
| InChI | InChI=1S/C22H25NO7/c1-21(2,3)20-29-19(25)22(30-20,15-8-6-5-7-9-15)16(13-23(26)27)14-10-11-17(24)18(12-14)28-4/h5-12,16,20,24H,13H2,1-4H3/t16-,20+,22+/m0/s1 |
| InChIKey | WTVGMBHKPGTFKV-SAWYMBPVSA-N |
| XLogP | 3.60 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|