C26H32N4+2 — CID 102047989
1-(4-pyrrol-1-ylbutyl)-4-[1-(4-pyrrol-1-ylbutyl)pyridin-1-ium-4-yl]pyridin-1-ium (PubChem CID 102047989) has the molecular formula C26H32N4+2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-(4-pyrrol-1-ylbutyl)-4-[1-(4-pyrrol-1-ylbutyl)pyridin-1-ium-4-yl]pyridin-1-ium.
| Compound Name | 1-(4-pyrrol-1-ylbutyl)-4-[1-(4-pyrrol-1-ylbutyl)pyridin-1-ium-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 102047989 |
| Molecular Formula | C26H32N4+2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-(4-pyrrol-1-ylbutyl)-4-[1-(4-pyrrol-1-ylbutyl)pyridin-1-ium-4-yl]pyridin-1-ium |
| SMILES | c1ccn(CCCC[n+]2ccc(-c3cc[n+](CCCCn4cccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C26H32N4/c1-2-14-27(13-1)17-5-7-19-29-21-9-25(10-22-29)26-11-23-30(24-12-26)20-8-6-18-28-15-3-4-16-28/h1-4,9-16,21-24H,5-8,17-20H2/q+2 |
| InChIKey | RDWFBIBGEPUWQV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|