C16H22O2Si — CID 102048288
ethyl (2Z)-2-(2,2-dimethyl-4,5-dihydro-1H-2-benzosilepin-3-ylidene)acetate (PubChem CID 102048288) has the molecular formula C16H22O2Si and a molecular weight of 274.44 g/mol. Its IUPAC name is ethyl (2Z)-2-(2,2-dimethyl-4,5-dihydro-1H-2-benzosilepin-3-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-(2,2-dimethyl-4,5-dihydro-1H-2-benzosilepin-3-ylidene)acetate |
|---|---|
| PubChem CID | 102048288 |
| Molecular Formula | C16H22O2Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | ethyl (2Z)-2-(2,2-dimethyl-4,5-dihydro-1H-2-benzosilepin-3-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1/CCc2ccccc2C[Si]1(C)C |
| InChI | InChI=1S/C16H22O2Si/c1-4-18-16(17)11-15-10-9-13-7-5-6-8-14(13)12-19(15,2)3/h5-8,11H,4,9-10,12H2,1-3H3/b15-11- |
| InChIKey | JFPXZEFFNFEDEY-PTNGSMBKSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|