C21H34O4 — CID 102049342
[(2S,4aS,6S,8aS)-6-[(1S,2S)-2-(2-hydroxyethyl)-2-methylcyclopentyl]-4a-methyl-5-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl] acetate (PubChem CID 102049342) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is [(2S,4aS,6S,8aS)-6-[(1S,2S)-2-(2-hydroxyethyl)-2-methylcyclopentyl]-4a-methyl-5-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl] acetate.
| Compound Name | [(2S,4aS,6S,8aS)-6-[(1S,2S)-2-(2-hydroxyethyl)-2-methylcyclopentyl]-4a-methyl-5-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 102049342 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | [(2S,4aS,6S,8aS)-6-[(1S,2S)-2-(2-hydroxyethyl)-2-methylcyclopentyl]-4a-methyl-5-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C(=O)[C@H]([C@@H]3CCC[C@@]3(C)CCO)CC[C@H]2C1 |
| InChI | InChI=1S/C21H34O4/c1-14(23)25-16-8-10-21(3)15(13-16)6-7-17(19(21)24)18-5-4-9-20(18,2)11-12-22/h15-18,22H,4-13H2,1-3H3/t15-,16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | ICQABZDIGCQBFI-ZKHIMWLXSA-N |
| XLogP | 3.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |