C15H16Cl4O2 — CID 102049621
(1,1,1-trichloro-3-methylbut-2-en-2-yl) (2S)-2-chloro-2-phenylbutanoate (PubChem CID 102049621) has the molecular formula C15H16Cl4O2 and a molecular weight of 370.10 g/mol. Its IUPAC name is (1,1,1-trichloro-3-methylbut-2-en-2-yl) (2S)-2-chloro-2-phenylbutanoate.
| Compound Name | (1,1,1-trichloro-3-methylbut-2-en-2-yl) (2S)-2-chloro-2-phenylbutanoate |
|---|---|
| PubChem CID | 102049621 |
| Molecular Formula | C15H16Cl4O2 |
| Molecular Weight | 370.10 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | (1,1,1-trichloro-3-methylbut-2-en-2-yl) (2S)-2-chloro-2-phenylbutanoate |
| SMILES | CC[C@@](Cl)(C(=O)OC(=C(C)C)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C15H16Cl4O2/c1-4-14(16,11-8-6-5-7-9-11)13(20)21-12(10(2)3)15(17,18)19/h5-9H,4H2,1-3H3/t14-/m0/s1 |
| InChIKey | JFWJEYTVFNICJV-AWEZNQCLSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.10 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|