About 2-phenylbutan-2-yl ethaneperoxoate
2-phenylbutan-2-yl ethaneperoxoate (PubChem CID 167293135) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-phenylbutan-2-yl ethaneperoxoate.
Molecular Properties
| Compound Name | 2-phenylbutan-2-yl ethaneperoxoate |
| PubChem CID | 167293135 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-phenylbutan-2-yl ethaneperoxoate |
| SMILES | CCC(C)(OOC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O3/c1-4-12(3,15-14-10(2)13)11-8-6-5-7-9-11/h5-9H,4H2,1-3H3 |
| InChIKey | FVIAXBUJHXPRRJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylbutan-2-yl ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylbutan-2-yl ethaneperoxoate?
The IUPAC name of 2-phenylbutan-2-yl ethaneperoxoate (CID 167293135) is 2-phenylbutan-2-yl ethaneperoxoate.
What is the SMILES notation for 2-phenylbutan-2-yl ethaneperoxoate?
The canonical SMILES for 2-phenylbutan-2-yl ethaneperoxoate is CCC(C)(OOC(C)=O)c1ccccc1.
What is the InChIKey of 2-phenylbutan-2-yl ethaneperoxoate?
The InChIKey is FVIAXBUJHXPRRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-4-12(3,15-14-10(2)13)11-8-6-5-7-9-11/h5-9H,4H2,1-3H3.
What are the key properties of 2-phenylbutan-2-yl ethaneperoxoate?
2-phenylbutan-2-yl ethaneperoxoate has a molecular weight of 208.26 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylbutan-2-yl ethaneperoxoate is sourced from PubChem (CID 167293135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).