About 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate
2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate (PubChem CID 139777636) has the molecular formula C22H26O5
and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate.
Molecular Properties
| Compound Name | 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate |
| PubChem CID | 139777636 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate |
| SMILES | CCC(C)(OC(=O)OOC(C)(C)C)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26O5/c1-6-22(5,25-20(24)26-27-21(2,3)4)18-14-12-17(13-15-18)19(23)16-10-8-7-9-11-16/h7-15H,6H2,1-5H3 |
| InChIKey | DYJNHQJFQYGAOH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate?
The IUPAC name of 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate (CID 139777636) is 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate.
What is the SMILES notation for 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate?
The canonical SMILES for 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate is CCC(C)(OC(=O)OOC(C)(C)C)c1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate?
The InChIKey is DYJNHQJFQYGAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O5/c1-6-22(5,25-20(24)26-27-21(2,3)4)18-14-12-17(13-15-18)19(23)16-10-8-7-9-11-16/h7-15H,6H2,1-5H3.
What are the key properties of 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate?
2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate has a molecular weight of 370.45 g/mol, XLogP of 5.43, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzoylphenyl)butan-2-yl (2-methylpropan-2-yl)oxy carbonate is sourced from PubChem (CID 139777636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).