C22H26N2O7S — CID 10204966
2-[[2-[[4-(2,2-dimethylpropanoyloxy)-3-methylphenyl]sulfonylamino]benzoyl]amino]propanoic acid (PubChem CID 10204966) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[[2-[[4-(2,2-dimethylpropanoyloxy)-3-methylphenyl]sulfonylamino]benzoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[4-(2,2-dimethylpropanoyloxy)-3-methylphenyl]sulfonylamino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10204966 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[[2-[[4-(2,2-dimethylpropanoyloxy)-3-methylphenyl]sulfonylamino]benzoyl]amino]propanoic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccccc2C(=O)NC(C)C(=O)O)ccc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H26N2O7S/c1-13-12-15(10-11-18(13)31-21(28)22(3,4)5)32(29,30)24-17-9-7-6-8-16(17)19(25)23-14(2)20(26)27/h6-12,14,24H,1-5H3,(H,23,25)(H,26,27) |
| InChIKey | HTKAMUMPMIFGDL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|