C12H16O9 — CID 102050295
trimethyl 2-hydroxy-6,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 102050295) has the molecular formula C12H16O9 and a molecular weight of 304.25 g/mol. Its IUPAC name is trimethyl 2-hydroxy-6,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | trimethyl 2-hydroxy-6,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 102050295 |
| Molecular Formula | C12H16O9 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | trimethyl 2-hydroxy-6,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1C(O)C2COC(C(=O)OC)(O2)C1C(=O)OC |
| InChI | InChI=1S/C12H16O9/c1-17-9(14)6-7(10(15)18-2)12(11(16)19-3)20-4-5(21-12)8(6)13/h5-8,13H,4H2,1-3H3 |
| InChIKey | ZWSUBLILNGCYOB-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|