C12H17NO9 — CID 23260823
tetramethyl (4R,5R)-2-methyl-1,2-oxazolidine-3,3,4,5-tetracarboxylate (PubChem CID 23260823) has the molecular formula C12H17NO9 and a molecular weight of 319.27 g/mol. Its IUPAC name is tetramethyl (4R,5R)-2-methyl-1,2-oxazolidine-3,3,4,5-tetracarboxylate.
| Compound Name | tetramethyl (4R,5R)-2-methyl-1,2-oxazolidine-3,3,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 23260823 |
| Molecular Formula | C12H17NO9 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | tetramethyl (4R,5R)-2-methyl-1,2-oxazolidine-3,3,4,5-tetracarboxylate |
| SMILES | COC(=O)[C@@H]1ON(C)C(C(=O)OC)(C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C12H17NO9/c1-13-12(10(16)20-4,11(17)21-5)6(8(14)18-2)7(22-13)9(15)19-3/h6-7H,1-5H3/t6-,7-/m1/s1 |
| InChIKey | YSEGDGGEHBXWEE-RNFRBKRXSA-N |
| XLogP | -1.72 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|