C14H21N4O2+ — CID 102052839
[(E,4Z)-4-(dimethylhydrazinylidene)-2-(4-nitrophenyl)but-2-enyl]-dimethylazanium (PubChem CID 102052839) has the molecular formula C14H21N4O2+ and a molecular weight of 277.35 g/mol. Its IUPAC name is [(E,4Z)-4-(dimethylhydrazinylidene)-2-(4-nitrophenyl)but-2-enyl]-dimethylazanium.
| Compound Name | [(E,4Z)-4-(dimethylhydrazinylidene)-2-(4-nitrophenyl)but-2-enyl]-dimethylazanium |
|---|---|
| PubChem CID | 102052839 |
| Molecular Formula | C14H21N4O2+ |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [(E,4Z)-4-(dimethylhydrazinylidene)-2-(4-nitrophenyl)but-2-enyl]-dimethylazanium |
| SMILES | CN(C)/N=C\C=C(\C[NH+](C)C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N4O2/c1-16(2)11-13(9-10-15-17(3)4)12-5-7-14(8-6-12)18(19)20/h5-10H,11H2,1-4H3/p+1/b13-9-,15-10- |
| InChIKey | BIMMFEUGAXYNNP-VIYDEIPASA-O |
| XLogP | 0.67 |
| TPSA | 63.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|