C18H18N2O2 — CID 90893245
N,N-dimethyl-4-(4-nitrophenyl)-4-phenylbuta-1,3-dien-1-amine (PubChem CID 90893245) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-nitrophenyl)-4-phenylbuta-1,3-dien-1-amine.
| Compound Name | N,N-dimethyl-4-(4-nitrophenyl)-4-phenylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 90893245 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N,N-dimethyl-4-(4-nitrophenyl)-4-phenylbuta-1,3-dien-1-amine |
| SMILES | CN(C)C=CC=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-19(2)14-6-9-18(15-7-4-3-5-8-15)16-10-12-17(13-11-16)20(21)22/h3-14H,1-2H3 |
| InChIKey | UZAOHZJIFBBYKO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|