C24H21F2NO3S — CID 102053059
[1-(benzenesulfonyl)-4-(4-fluorophenyl)piperidin-4-yl]-(4-fluorophenyl)methanone (PubChem CID 102053059) has the molecular formula C24H21F2NO3S and a molecular weight of 441.50 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-4-(4-fluorophenyl)piperidin-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-(benzenesulfonyl)-4-(4-fluorophenyl)piperidin-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 102053059 |
| Molecular Formula | C24H21F2NO3S |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [1-(benzenesulfonyl)-4-(4-fluorophenyl)piperidin-4-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)C1(c2ccc(F)cc2)CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H21F2NO3S/c25-20-10-6-18(7-11-20)23(28)24(19-8-12-21(26)13-9-19)14-16-27(17-15-24)31(29,30)22-4-2-1-3-5-22/h1-13H,14-17H2 |
| InChIKey | MHGWZSRVFIWYHM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |