C28H33F2NO3 — CID 10205387
1-[(2S)-2-[5,5-bis(4-fluorophenyl)pentanoyl]pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione (PubChem CID 10205387) has the molecular formula C28H33F2NO3 and a molecular weight of 469.57 g/mol. Its IUPAC name is 1-[(2S)-2-[5,5-bis(4-fluorophenyl)pentanoyl]pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione.
| Compound Name | 1-[(2S)-2-[5,5-bis(4-fluorophenyl)pentanoyl]pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione |
|---|---|
| PubChem CID | 10205387 |
| Molecular Formula | C28H33F2NO3 |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 1-[(2S)-2-[5,5-bis(4-fluorophenyl)pentanoyl]pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=O)CCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H33F2NO3/c1-4-28(2,3)26(33)27(34)31-18-6-8-24(31)25(32)9-5-7-23(19-10-14-21(29)15-11-19)20-12-16-22(30)17-13-20/h10-17,23-24H,4-9,18H2,1-3H3/t24-/m0/s1 |
| InChIKey | AIVSIPTYNHWBTO-DEOSSOPVSA-N |
| XLogP | 5.83 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|