C19H21Br2NO5 — CID 102054414
dimethyl 2-(bromomethyl)-2-(4-bromophenyl)-5-tert-butyliminofuran-3,4-dicarboxylate (PubChem CID 102054414) has the molecular formula C19H21Br2NO5 and a molecular weight of 503.19 g/mol. Its IUPAC name is dimethyl 2-(bromomethyl)-2-(4-bromophenyl)-5-tert-butyliminofuran-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(bromomethyl)-2-(4-bromophenyl)-5-tert-butyliminofuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102054414 |
| Molecular Formula | C19H21Br2NO5 |
| Molecular Weight | 503.19 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | dimethyl 2-(bromomethyl)-2-(4-bromophenyl)-5-tert-butyliminofuran-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(CBr)(c2ccc(Br)cc2)O/C1=N\C(C)(C)C |
| InChI | InChI=1S/C19H21Br2NO5/c1-18(2,3)22-15-13(16(23)25-4)14(17(24)26-5)19(10-20,27-15)11-6-8-12(21)9-7-11/h6-9H,10H2,1-5H3/b22-15- |
| InChIKey | BBUZJUVEUMKYMT-JCMHNJIXSA-N |
| XLogP | 3.91 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|