C19H20N2O5 — CID 101391009
dimethyl 5-tert-butylimino-2-cyano-2-phenylfuran-3,4-dicarboxylate (PubChem CID 101391009) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is dimethyl 5-tert-butylimino-2-cyano-2-phenylfuran-3,4-dicarboxylate.
| Compound Name | dimethyl 5-tert-butylimino-2-cyano-2-phenylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101391009 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | dimethyl 5-tert-butylimino-2-cyano-2-phenylfuran-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C#N)(c2ccccc2)O/C1=N\C(C)(C)C |
| InChI | InChI=1S/C19H20N2O5/c1-18(2,3)21-15-13(16(22)24-4)14(17(23)25-5)19(11-20,26-15)12-9-7-6-8-10-12/h6-10H,1-5H3/b21-15- |
| InChIKey | FFJHNIVSPUMLJO-QNGOZBTKSA-N |
| XLogP | 2.28 |
| TPSA | 97.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|