C18H22ClNO3 — CID 139215248
ethyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3-carboxylate (PubChem CID 139215248) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is ethyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3-carboxylate.
| Compound Name | ethyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3-carboxylate |
|---|---|
| PubChem CID | 139215248 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | ethyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3-carboxylate |
| SMILES | CCOC(=O)C1=C/C(=N\C(C)(C)C)OC1(CCl)c1ccccc1 |
| InChI | InChI=1S/C18H22ClNO3/c1-5-22-16(21)14-11-15(20-17(2,3)4)23-18(14,12-19)13-9-7-6-8-10-13/h6-11H,5,12H2,1-4H3/b20-15+ |
| InChIKey | KKHYTCWXHKARHU-HMMYKYKNSA-N |
| XLogP | 3.84 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|