C25H34ClNO5 — CID 102054412
diethyl 2-(chloromethyl)-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate (PubChem CID 102054412) has the molecular formula C25H34ClNO5 and a molecular weight of 464.00 g/mol. Its IUPAC name is diethyl 2-(chloromethyl)-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate.
| Compound Name | diethyl 2-(chloromethyl)-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102054412 |
| Molecular Formula | C25H34ClNO5 |
| Molecular Weight | 464.00 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | diethyl 2-(chloromethyl)-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C(CCl)(c2ccccc2)O/C1=N\C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C25H34ClNO5/c1-8-30-21(28)18-19(22(29)31-9-2)25(16-26,17-13-11-10-12-14-17)32-20(18)27-24(6,7)15-23(3,4)5/h10-14H,8-9,15-16H2,1-7H3/b27-20- |
| InChIKey | JJPDQKOZNKCUNH-OOAXWGSJSA-N |
| XLogP | 5.19 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.00 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|