C17H20ClNO3 — CID 139215254
methyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3-carboxylate (PubChem CID 139215254) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is methyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3-carboxylate.
| Compound Name | methyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3-carboxylate |
|---|---|
| PubChem CID | 139215254 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | methyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3-carboxylate |
| SMILES | COC(=O)C1=C/C(=N\C(C)(C)C)OC1(CCl)c1ccccc1 |
| InChI | InChI=1S/C17H20ClNO3/c1-16(2,3)19-14-10-13(15(20)21-4)17(11-18,22-14)12-8-6-5-7-9-12/h5-10H,11H2,1-4H3/b19-14+ |
| InChIKey | ZVWDXHBMORHUCS-XMHGGMMESA-N |
| XLogP | 3.45 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|