C22H27NO7 — CID 102210721
3-O,4-O-diethyl 2-O-methyl 5-tert-butylimino-2-phenylfuran-2,3,4-tricarboxylate (PubChem CID 102210721) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is 3-O,4-O-diethyl 2-O-methyl 5-tert-butylimino-2-phenylfuran-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-diethyl 2-O-methyl 5-tert-butylimino-2-phenylfuran-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 102210721 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-O,4-O-diethyl 2-O-methyl 5-tert-butylimino-2-phenylfuran-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C(C(=O)OC)(c2ccccc2)O/C1=N\C(C)(C)C |
| InChI | InChI=1S/C22H27NO7/c1-7-28-18(24)15-16(19(25)29-8-2)22(20(26)27-6,14-12-10-9-11-13-14)30-17(15)23-21(3,4)5/h9-13H,7-8H2,1-6H3/b23-17- |
| InChIKey | GWLVWOBDEYUPQX-QJOMJCCJSA-N |
| XLogP | 2.70 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|