C21H29NO4 — CID 135006199
[(1S)-1-[(5R)-5-butyl-4-oxo-2-phenyl-1,3-oxazol-5-yl]hexyl] acetate (PubChem CID 135006199) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is [(1S)-1-[(5R)-5-butyl-4-oxo-2-phenyl-1,3-oxazol-5-yl]hexyl] acetate.
| Compound Name | [(1S)-1-[(5R)-5-butyl-4-oxo-2-phenyl-1,3-oxazol-5-yl]hexyl] acetate |
|---|---|
| PubChem CID | 135006199 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [(1S)-1-[(5R)-5-butyl-4-oxo-2-phenyl-1,3-oxazol-5-yl]hexyl] acetate |
| SMILES | CCCCC[C@H](OC(C)=O)[C@@]1(CCCC)OC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C21H29NO4/c1-4-6-9-14-18(25-16(3)23)21(15-7-5-2)20(24)22-19(26-21)17-12-10-8-11-13-17/h8,10-13,18H,4-7,9,14-15H2,1-3H3/t18-,21+/m0/s1 |
| InChIKey | VKFWORFNVHSVBG-GHTZIAJQSA-N |
| XLogP | 4.43 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|