C22H23NO2 — CID 101340931
(5R)-5-butyl-2-phenyl-5-[(1S)-1-phenylprop-2-enyl]-1,3-oxazol-4-one (PubChem CID 101340931) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (5R)-5-butyl-2-phenyl-5-[(1S)-1-phenylprop-2-enyl]-1,3-oxazol-4-one.
| Compound Name | (5R)-5-butyl-2-phenyl-5-[(1S)-1-phenylprop-2-enyl]-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 101340931 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (5R)-5-butyl-2-phenyl-5-[(1S)-1-phenylprop-2-enyl]-1,3-oxazol-4-one |
| SMILES | C=C[C@@H](c1ccccc1)[C@@]1(CCCC)OC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C22H23NO2/c1-3-5-16-22(19(4-2)17-12-8-6-9-13-17)21(24)23-20(25-22)18-14-10-7-11-15-18/h4,6-15,19H,2-3,5,16H2,1H3/t19-,22+/m0/s1 |
| InChIKey | YQVNFYMYMNIBIQ-SIKLNZKXSA-N |
| XLogP | 4.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|