C22H31NO4 — CID 135006195
[(1S)-1-[(5R)-5-methyl-4-oxo-2-phenyl-1,3-oxazol-5-yl]decyl] acetate (PubChem CID 135006195) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is [(1S)-1-[(5R)-5-methyl-4-oxo-2-phenyl-1,3-oxazol-5-yl]decyl] acetate.
| Compound Name | [(1S)-1-[(5R)-5-methyl-4-oxo-2-phenyl-1,3-oxazol-5-yl]decyl] acetate |
|---|---|
| PubChem CID | 135006195 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | [(1S)-1-[(5R)-5-methyl-4-oxo-2-phenyl-1,3-oxazol-5-yl]decyl] acetate |
| SMILES | CCCCCCCCC[C@H](OC(C)=O)[C@@]1(C)OC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C22H31NO4/c1-4-5-6-7-8-9-13-16-19(26-17(2)24)22(3)21(25)23-20(27-22)18-14-11-10-12-15-18/h10-12,14-15,19H,4-9,13,16H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | PWNRXHKPGDEGKT-SIKLNZKXSA-N |
| XLogP | 4.82 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|