C23H27Br2NO5 — CID 102054413
diethyl 2-(bromomethyl)-2-(4-bromophenyl)-5-cyclohexyliminofuran-3,4-dicarboxylate (PubChem CID 102054413) has the molecular formula C23H27Br2NO5 and a molecular weight of 557.28 g/mol. Its IUPAC name is diethyl 2-(bromomethyl)-2-(4-bromophenyl)-5-cyclohexyliminofuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-(bromomethyl)-2-(4-bromophenyl)-5-cyclohexyliminofuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102054413 |
| Molecular Formula | C23H27Br2NO5 |
| Molecular Weight | 557.28 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | diethyl 2-(bromomethyl)-2-(4-bromophenyl)-5-cyclohexyliminofuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C(CBr)(c2ccc(Br)cc2)O/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C23H27Br2NO5/c1-3-29-21(27)18-19(22(28)30-4-2)23(14-24,15-10-12-16(25)13-11-15)31-20(18)26-17-8-6-5-7-9-17/h10-13,17H,3-9,14H2,1-2H3/b26-20- |
| InChIKey | HUHPMESAPZLPBF-QOMWVZHYSA-N |
| XLogP | 5.22 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.28 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|