C25H19N5O3 — CID 102054566
2-[[7-(diethylamino)-2-iminochromen-3-yl]-(1,3-dioxoisoindol-2-yl)methylidene]propanedinitrile (PubChem CID 102054566) has the molecular formula C25H19N5O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 2-[[7-(diethylamino)-2-iminochromen-3-yl]-(1,3-dioxoisoindol-2-yl)methylidene]propanedinitrile.
| Compound Name | 2-[[7-(diethylamino)-2-iminochromen-3-yl]-(1,3-dioxoisoindol-2-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 102054566 |
| Molecular Formula | C25H19N5O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[[7-(diethylamino)-2-iminochromen-3-yl]-(1,3-dioxoisoindol-2-yl)methylidene]propanedinitrile |
| SMILES | [H]/N=c1\oc2cc(N(CC)CC)ccc2cc1C(=C(C#N)C#N)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H19N5O3/c1-3-29(4-2)17-10-9-15-11-20(23(28)33-21(15)12-17)22(16(13-26)14-27)30-24(31)18-7-5-6-8-19(18)25(30)32/h5-12,28H,3-4H2,1-2H3/b28-23- |
| InChIKey | QOUDFMPAQPLCNK-NFFVHWSESA-N |
| XLogP | 3.81 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|