C22H25N3O4S — CID 19289072
propan-2-yl 2-[[7-(diethylamino)-2-iminochromene-3-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 19289072) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is propan-2-yl 2-[[7-(diethylamino)-2-iminochromene-3-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[7-(diethylamino)-2-iminochromene-3-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19289072 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | propan-2-yl 2-[[7-(diethylamino)-2-iminochromene-3-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | [H]/N=c1\oc2cc(N(CC)CC)ccc2cc1C(=O)Nc1sccc1C(=O)OC(C)C |
| InChI | InChI=1S/C22H25N3O4S/c1-5-25(6-2)15-8-7-14-11-17(19(23)29-18(14)12-15)20(26)24-21-16(9-10-30-21)22(27)28-13(3)4/h7-13,23H,5-6H2,1-4H3,(H,24,26)/b23-19- |
| InChIKey | UTSSXQQJVGUETK-NMWGTECJSA-N |
| XLogP | 4.64 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |