C21H26O5 — CID 102057013
(1R,3S,4aS,6Z,8E,12aR)-3-(furan-3-yl)-1-methoxy-4a-methyl-10-methylidene-3,4,5,11,12,12a-hexahydro-1H-cyclodeca[c]pyran-9-carboxylic acid (PubChem CID 102057013) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (1R,3S,4aS,6Z,8E,12aR)-3-(furan-3-yl)-1-methoxy-4a-methyl-10-methylidene-3,4,5,11,12,12a-hexahydro-1H-cyclodeca[c]pyran-9-carboxylic acid.
| Compound Name | (1R,3S,4aS,6Z,8E,12aR)-3-(furan-3-yl)-1-methoxy-4a-methyl-10-methylidene-3,4,5,11,12,12a-hexahydro-1H-cyclodeca[c]pyran-9-carboxylic acid |
|---|---|
| PubChem CID | 102057013 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1R,3S,4aS,6Z,8E,12aR)-3-(furan-3-yl)-1-methoxy-4a-methyl-10-methylidene-3,4,5,11,12,12a-hexahydro-1H-cyclodeca[c]pyran-9-carboxylic acid |
| SMILES | C=C1CC[C@H]2[C@H](OC)O[C@H](c3ccoc3)C[C@]2(C)C/C=C\C=C/1C(=O)O |
| InChI | InChI=1S/C21H26O5/c1-14-7-8-17-20(24-3)26-18(15-9-11-25-13-15)12-21(17,2)10-5-4-6-16(14)19(22)23/h4-6,9,11,13,17-18,20H,1,7-8,10,12H2,2-3H3,(H,22,23)/b5-4-,16-6+/t17-,18-,20+,21-/m0/s1 |
| InChIKey | ZZAZUUTVAXRFKE-MFGUQWCFSA-N |
| XLogP | 4.64 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |