C7H5F4NO2 — CID 102057541
1-oxido-3-(1,2,2,2-tetrafluoroethoxy)pyridin-1-ium (PubChem CID 102057541) has the molecular formula C7H5F4NO2 and a molecular weight of 211.11 g/mol. Its IUPAC name is 1-oxido-3-(1,2,2,2-tetrafluoroethoxy)pyridin-1-ium.
| Compound Name | 1-oxido-3-(1,2,2,2-tetrafluoroethoxy)pyridin-1-ium |
|---|---|
| PubChem CID | 102057541 |
| Molecular Formula | C7H5F4NO2 |
| Molecular Weight | 211.11 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 1-oxido-3-(1,2,2,2-tetrafluoroethoxy)pyridin-1-ium |
| SMILES | [O-][n+]1cccc(OC(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C7H5F4NO2/c8-6(7(9,10)11)14-5-2-1-3-12(13)4-5/h1-4,6H |
| InChIKey | HAUUBJDOKBKWDU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 36.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.11 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|