C16H12ClFO — CID 102058457
6-chloro-4-(3-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 102058457) has the molecular formula C16H12ClFO and a molecular weight of 274.72 g/mol. Its IUPAC name is 6-chloro-4-(3-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-chloro-4-(3-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 102058457 |
| Molecular Formula | C16H12ClFO |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 6-chloro-4-(3-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCC(c2cccc(F)c2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H12ClFO/c17-11-4-5-14-15(9-11)13(6-7-16(14)19)10-2-1-3-12(18)8-10/h1-5,8-9,13H,6-7H2 |
| InChIKey | AZJMLGGXWDLGHF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |