C18H22BrNO2 — CID 102059332
(1S,2S,3R,4R)-3-(bromomethyl)-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 102059332) has the molecular formula C18H22BrNO2 and a molecular weight of 364.28 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-(bromomethyl)-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-(bromomethyl)-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 102059332 |
| Molecular Formula | C18H22BrNO2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (1S,2S,3R,4R)-3-(bromomethyl)-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)[C@@H]1[C@H](CBr)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C18H22BrNO2/c19-10-16-13-6-7-14(9-13)17(16)18(22)20-15(11-21)8-12-4-2-1-3-5-12/h1-7,13-17,21H,8-11H2,(H,20,22)/t13-,14+,15-,16+,17-/m0/s1 |
| InChIKey | HFWDOXIAYZTXCU-NNXHMXCWSA-N |
| XLogP | 2.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|