C15H21NO3 — CID 81329667
N-(1-hydroxy-3-phenylpropan-2-yl)-5-methyloxolane-2-carboxamide (PubChem CID 81329667) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)-5-methyloxolane-2-carboxamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)-5-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 81329667 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)-5-methyloxolane-2-carboxamide |
| SMILES | CC1CCC(C(=O)NC(CO)Cc2ccccc2)O1 |
| InChI | InChI=1S/C15H21NO3/c1-11-7-8-14(19-11)15(18)16-13(10-17)9-12-5-3-2-4-6-12/h2-6,11,13-14,17H,7-10H2,1H3,(H,16,18) |
| InChIKey | CGUALVIRUFVTGQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |