C20H32O4 — CID 102059842
(1R,2S,4S,5S,6R,9S,10S,13R)-5,14-bis(hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-2,6-diol (PubChem CID 102059842) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1R,2S,4S,5S,6R,9S,10S,13R)-5,14-bis(hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-2,6-diol.
| Compound Name | (1R,2S,4S,5S,6R,9S,10S,13R)-5,14-bis(hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-2,6-diol |
|---|---|
| PubChem CID | 102059842 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1R,2S,4S,5S,6R,9S,10S,13R)-5,14-bis(hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-2,6-diol |
| SMILES | C[C@@]1(CO)[C@H]2C[C@H](O)[C@]34C=C(CO)[C@H](CC[C@H]3[C@]2(C)CC[C@H]1O)C4 |
| InChI | InChI=1S/C20H32O4/c1-18-6-5-16(23)19(2,11-22)15(18)7-17(24)20-8-12(3-4-14(18)20)13(9-20)10-21/h9,12,14-17,21-24H,3-8,10-11H2,1-2H3/t12-,14+,15+,16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | HCTUZNMZWMKOBW-XTSCITRTSA-N |
| XLogP | 1.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|