C14H18O — CID 102060571
(1S,4S,5R,6S,8S)-3,3-dimethyl-11-methylidenetetracyclo[6.3.0.01,5.04,6]undecan-7-one (PubChem CID 102060571) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (1S,4S,5R,6S,8S)-3,3-dimethyl-11-methylidenetetracyclo[6.3.0.01,5.04,6]undecan-7-one.
| Compound Name | (1S,4S,5R,6S,8S)-3,3-dimethyl-11-methylidenetetracyclo[6.3.0.01,5.04,6]undecan-7-one |
|---|---|
| PubChem CID | 102060571 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (1S,4S,5R,6S,8S)-3,3-dimethyl-11-methylidenetetracyclo[6.3.0.01,5.04,6]undecan-7-one |
| SMILES | C=C1CC[C@@H]2C(=O)[C@H]3[C@@H]4[C@H]3[C@]12CC4(C)C |
| InChI | InChI=1S/C14H18O/c1-7-4-5-8-12(15)9-10-11(9)14(7,8)6-13(10,2)3/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-,11+,14-/m1/s1 |
| InChIKey | LLIFSYMEGPBXIG-AHMQBVQWSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|