C29H36O2 — CID 102061174
(1S,4R,13S,16Z,19R)-4,15,15,19-tetramethyl-5,20-dioxapentacyclo[17.8.0.04,13.06,11.021,26]heptacosa-6,8,10,16,21,23,25-heptaene (PubChem CID 102061174) has the molecular formula C29H36O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is (1S,4R,13S,16Z,19R)-4,15,15,19-tetramethyl-5,20-dioxapentacyclo[17.8.0.04,13.06,11.021,26]heptacosa-6,8,10,16,21,23,25-heptaene.
| Compound Name | (1S,4R,13S,16Z,19R)-4,15,15,19-tetramethyl-5,20-dioxapentacyclo[17.8.0.04,13.06,11.021,26]heptacosa-6,8,10,16,21,23,25-heptaene |
|---|---|
| PubChem CID | 102061174 |
| Molecular Formula | C29H36O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (1S,4R,13S,16Z,19R)-4,15,15,19-tetramethyl-5,20-dioxapentacyclo[17.8.0.04,13.06,11.021,26]heptacosa-6,8,10,16,21,23,25-heptaene |
| SMILES | CC1(C)/C=C\C[C@@]2(C)Oc3ccccc3C[C@@H]2CC[C@@]2(C)Oc3ccccc3C[C@@H]2C1 |
| InChI | InChI=1S/C29H36O2/c1-27(2)15-9-16-28(3)23(18-21-10-5-7-12-25(21)30-28)14-17-29(4)24(20-27)19-22-11-6-8-13-26(22)31-29/h5-13,15,23-24H,14,16-20H2,1-4H3/b15-9-/t23-,24+,28+,29+/m0/s1 |
| InChIKey | ISSPUSZYYOWQJE-FQGSZQHWSA-N |
| XLogP | 7.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|